C21H20F3N3O2S — CID 90802953
O-[(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)] N-[3-(trifluoromethyl)phenyl]carbamothioate (PubChem CID 90802953) has the molecular formula C21H20F3N3O2S and a molecular weight of 435.47 g/mol. Its IUPAC name is O-[(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)] N-[3-(trifluoromethyl)phenyl]carbamothioate.
| Compound Name | O-[(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)] N-[3-(trifluoromethyl)phenyl]carbamothioate |
|---|---|
| PubChem CID | 90802953 |
| Molecular Formula | C21H20F3N3O2S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | O-[(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)] N-[3-(trifluoromethyl)phenyl]carbamothioate |
| SMILES | FC(F)(F)c1cccc(NC(=S)ON2CCC3(C=C(c4ccccc4)NO3)CC2)c1 |
| InChI | InChI=1S/C21H20F3N3O2S/c22-21(23,24)16-7-4-8-17(13-16)25-19(30)28-27-11-9-20(10-12-27)14-18(26-29-20)15-5-2-1-3-6-15/h1-8,13-14,26H,9-12H2,(H,25,30) |
| InChIKey | JTZDHSFRYQLQSN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|