C22H28F3N3O2S — CID 90857957
O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(cyclohexylmethyl)carbamothioate (PubChem CID 90857957) has the molecular formula C22H28F3N3O2S and a molecular weight of 455.55 g/mol. Its IUPAC name is O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(cyclohexylmethyl)carbamothioate.
| Compound Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(cyclohexylmethyl)carbamothioate |
|---|---|
| PubChem CID | 90857957 |
| Molecular Formula | C22H28F3N3O2S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-(cyclohexylmethyl)carbamothioate |
| SMILES | FC(F)(F)c1ccc(C2=CC3(CCN(OC(=S)NCC4CCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C22H28F3N3O2S/c23-22(24,25)18-8-6-17(7-9-18)19-14-21(30-27-19)10-12-28(13-11-21)29-20(31)26-15-16-4-2-1-3-5-16/h6-9,14,16,27H,1-5,10-13,15H2,(H,26,31) |
| InChIKey | SEBADOODWSRNSM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|