C23H30F3N3O2S — CID 90799398
O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclooctylcarbamothioate (PubChem CID 90799398) has the molecular formula C23H30F3N3O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclooctylcarbamothioate.
| Compound Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclooctylcarbamothioate |
|---|---|
| PubChem CID | 90799398 |
| Molecular Formula | C23H30F3N3O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclooctylcarbamothioate |
| SMILES | FC(F)(F)c1ccc(C2=CC3(CCN(OC(=S)NC4CCCCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C23H30F3N3O2S/c24-23(25,26)18-10-8-17(9-11-18)20-16-22(31-28-20)12-14-29(15-13-22)30-21(32)27-19-6-4-2-1-3-5-7-19/h8-11,16,19,28H,1-7,12-15H2,(H,27,32) |
| InChIKey | CMUYCDJVNKGFOV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|