C21H26F3N3OS — CID 91413692
N-cyclohexyl-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 91413692) has the molecular formula C21H26F3N3OS and a molecular weight of 425.52 g/mol. Its IUPAC name is N-cyclohexyl-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | N-cyclohexyl-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91413692 |
| Molecular Formula | C21H26F3N3OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-cyclohexyl-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | FC(F)(F)c1ccc(C2=CC3(CCN(C(=S)NC4CCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C21H26F3N3OS/c22-21(23,24)16-8-6-15(7-9-16)18-14-20(28-26-18)10-12-27(13-11-20)19(29)25-17-4-2-1-3-5-17/h6-9,14,17,26H,1-5,10-13H2,(H,25,29) |
| InChIKey | BUUKWHYNCDFAAZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|