C23H30F3N3OS — CID 90900652
N-cyclooctyl-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 90900652) has the molecular formula C23H30F3N3OS and a molecular weight of 453.57 g/mol. Its IUPAC name is N-cyclooctyl-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | N-cyclooctyl-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 90900652 |
| Molecular Formula | C23H30F3N3OS |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-cyclooctyl-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | FC(F)(F)c1ccc(C2=CC3(CCN(C(=S)NC4CCCCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C23H30F3N3OS/c24-23(25,26)18-10-8-17(9-11-18)20-16-22(30-28-20)12-14-29(15-13-22)21(31)27-19-6-4-2-1-3-5-7-19/h8-11,16,19,28H,1-7,12-15H2,(H,27,31) |
| InChIKey | HSHFRVVPJGVXTO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|