C20H24F3N3O2S — CID 91231389
O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclopentylcarbamothioate (PubChem CID 91231389) has the molecular formula C20H24F3N3O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclopentylcarbamothioate.
| Compound Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclopentylcarbamothioate |
|---|---|
| PubChem CID | 91231389 |
| Molecular Formula | C20H24F3N3O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-cyclopentylcarbamothioate |
| SMILES | FC(F)(F)c1ccc(C2=CC3(CCN(OC(=S)NC4CCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C20H24F3N3O2S/c21-20(22,23)15-7-5-14(6-8-15)17-13-19(28-25-17)9-11-26(12-10-19)27-18(29)24-16-3-1-2-4-16/h5-8,13,16,25H,1-4,9-12H2,(H,24,29) |
| InChIKey | RAOACJULOYRQOZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|