C22H28F3N3OS — CID 91201902
N-(cyclohexylmethyl)-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 91201902) has the molecular formula C22H28F3N3OS and a molecular weight of 439.55 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | N-(cyclohexylmethyl)-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91201902 |
| Molecular Formula | C22H28F3N3OS |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-(cyclohexylmethyl)-3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | FC(F)(F)c1ccc(C2=CC3(CCN(C(=S)NCC4CCCCC4)CC3)ON2)cc1 |
| InChI | InChI=1S/C22H28F3N3OS/c23-22(24,25)18-8-6-17(7-9-18)19-14-21(29-27-19)10-12-28(13-11-21)20(30)26-15-16-4-2-1-3-5-16/h6-9,14,16,27H,1-5,10-13,15H2,(H,26,30) |
| InChIKey | MYTXPUMSIXOBJD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|