C21H20F3N3O2S — CID 91389453
O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate (PubChem CID 91389453) has the molecular formula C21H20F3N3O2S and a molecular weight of 435.47 g/mol. Its IUPAC name is O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate.
| Compound Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate |
|---|---|
| PubChem CID | 91389453 |
| Molecular Formula | C21H20F3N3O2S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | O-[[3-[4-(trifluoromethyl)phenyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate |
| SMILES | FC(F)(F)c1ccc(C2=CC3(CCN(OC(=S)Nc4ccccc4)CC3)ON2)cc1 |
| InChI | InChI=1S/C21H20F3N3O2S/c22-21(23,24)16-8-6-15(7-9-16)18-14-20(29-26-18)10-12-27(13-11-20)28-19(30)25-17-4-2-1-3-5-17/h1-9,14,26H,10-13H2,(H,25,30) |
| InChIKey | CBRLUPWMDZMADU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|