C18H21F3N4O6S — CID 90843867
N-[(2S)-1-[cyano(methyl)amino]-1-oxo-4-[4-(trifluoromethoxy)phenyl]sulfonylbutan-2-yl]morpholine-4-carboxamide (PubChem CID 90843867) has the molecular formula C18H21F3N4O6S and a molecular weight of 478.45 g/mol. Its IUPAC name is N-[(2S)-1-[cyano(methyl)amino]-1-oxo-4-[4-(trifluoromethoxy)phenyl]sulfonylbutan-2-yl]morpholine-4-carboxamide.
| Compound Name | N-[(2S)-1-[cyano(methyl)amino]-1-oxo-4-[4-(trifluoromethoxy)phenyl]sulfonylbutan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 90843867 |
| Molecular Formula | C18H21F3N4O6S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-[(2S)-1-[cyano(methyl)amino]-1-oxo-4-[4-(trifluoromethoxy)phenyl]sulfonylbutan-2-yl]morpholine-4-carboxamide |
| SMILES | CN(C#N)C(=O)[C@H](CCS(=O)(=O)c1ccc(OC(F)(F)F)cc1)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H21F3N4O6S/c1-24(12-22)16(26)15(23-17(27)25-7-9-30-10-8-25)6-11-32(28,29)14-4-2-13(3-5-14)31-18(19,20)21/h2-5,15H,6-11H2,1H3,(H,23,27)/t15-/m0/s1 |
| InChIKey | OGRCTGOQWIJDHL-HNNXBMFYSA-N |
| XLogP | 1.10 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|