C25H25FN2O — CID 90844715
2-(4-butan-2-ylphenyl)-7-[(4-fluorophenyl)methylamino]isoindol-1-ol (PubChem CID 90844715) has the molecular formula C25H25FN2O and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)-7-[(4-fluorophenyl)methylamino]isoindol-1-ol.
| Compound Name | 2-(4-butan-2-ylphenyl)-7-[(4-fluorophenyl)methylamino]isoindol-1-ol |
|---|---|
| PubChem CID | 90844715 |
| Molecular Formula | C25H25FN2O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)-7-[(4-fluorophenyl)methylamino]isoindol-1-ol |
| SMILES | CCC(C)c1ccc(-n2cc3cccc(NCc4ccc(F)cc4)c3c2O)cc1 |
| InChI | InChI=1S/C25H25FN2O/c1-3-17(2)19-9-13-22(14-10-19)28-16-20-5-4-6-23(24(20)25(28)29)27-15-18-7-11-21(26)12-8-18/h4-14,16-17,27,29H,3,15H2,1-2H3 |
| InChIKey | FKQQPFGUWSNPMA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |