C23H33NO7 — CID 90844971
[2-oxo-2-[(2,2,5-trimethyl-1,3-dioxan-5-yl)amino]ethyl] 2-heptanoyloxybenzoate (PubChem CID 90844971) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is [2-oxo-2-[(2,2,5-trimethyl-1,3-dioxan-5-yl)amino]ethyl] 2-heptanoyloxybenzoate.
| Compound Name | [2-oxo-2-[(2,2,5-trimethyl-1,3-dioxan-5-yl)amino]ethyl] 2-heptanoyloxybenzoate |
|---|---|
| PubChem CID | 90844971 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | [2-oxo-2-[(2,2,5-trimethyl-1,3-dioxan-5-yl)amino]ethyl] 2-heptanoyloxybenzoate |
| SMILES | CCCCCCC(=O)Oc1ccccc1C(=O)OCC(=O)NC1(C)COC(C)(C)OC1 |
| InChI | InChI=1S/C23H33NO7/c1-5-6-7-8-13-20(26)31-18-12-10-9-11-17(18)21(27)28-14-19(25)24-23(4)15-29-22(2,3)30-16-23/h9-12H,5-8,13-16H2,1-4H3,(H,24,25) |
| InChIKey | OBGIWDURYLDWDN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|