C12H11F3N4O2 — CID 90845548
4-[2-(3-azido-2,4,6-trifluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one (PubChem CID 90845548) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is 4-[2-(3-azido-2,4,6-trifluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one.
| Compound Name | 4-[2-(3-azido-2,4,6-trifluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90845548 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-[2-(3-azido-2,4,6-trifluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one |
| SMILES | [N-]=[N+]=Nc1c(F)cc(F)c(CC(O)C2CNC(=O)C2)c1F |
| InChI | InChI=1S/C12H11F3N4O2/c13-7-3-8(14)12(18-19-16)11(15)6(7)2-9(20)5-1-10(21)17-4-5/h3,5,9,20H,1-2,4H2,(H,17,21) |
| InChIKey | ODRXHDQPEPVFEX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|