C24H29ClN4O6S — CID 90846686
5-chloro-N-[2-[4-[[N-cyclohexyl-C-(nitromethyl)carbonimidoyl]sulfamoyl]phenyl]ethyl]-2-methoxybenzamide (PubChem CID 90846686) has the molecular formula C24H29ClN4O6S and a molecular weight of 537.04 g/mol. Its IUPAC name is 5-chloro-N-[2-[4-[[N-cyclohexyl-C-(nitromethyl)carbonimidoyl]sulfamoyl]phenyl]ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-[4-[[N-cyclohexyl-C-(nitromethyl)carbonimidoyl]sulfamoyl]phenyl]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 90846686 |
| Molecular Formula | C24H29ClN4O6S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 5-chloro-N-[2-[4-[[N-cyclohexyl-C-(nitromethyl)carbonimidoyl]sulfamoyl]phenyl]ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCc1ccc(S(=O)(=O)N/C(C[N+](=O)[O-])=N\C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29ClN4O6S/c1-35-22-12-9-18(25)15-21(22)24(30)26-14-13-17-7-10-20(11-8-17)36(33,34)28-23(16-29(31)32)27-19-5-3-2-4-6-19/h7-12,15,19H,2-6,13-14,16H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | HKOBAMIIYUWEGX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|