C12H24ClN3O — CID 90847888
N-[2-[(E)-5-aminohex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-yl]hydroxylamine;hydrochloride (PubChem CID 90847888) has the molecular formula C12H24ClN3O and a molecular weight of 261.80 g/mol. Its IUPAC name is N-[2-[(E)-5-aminohex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-yl]hydroxylamine;hydrochloride.
| Compound Name | N-[2-[(E)-5-aminohex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-yl]hydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 90847888 |
| Molecular Formula | C12H24ClN3O |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-[2-[(E)-5-aminohex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-yl]hydroxylamine;hydrochloride |
| SMILES | CC(N)C/C=C/CC1CCCCC(NO)=N1.Cl |
| InChI | InChI=1S/C12H23N3O.ClH/c1-10(13)6-2-3-7-11-8-4-5-9-12(14-11)15-16;/h2-3,10-11,16H,4-9,13H2,1H3,(H,14,15);1H/b3-2+; |
| InChIKey | MUMQRZHBMXGCKA-SQQVDAMQSA-N |
| XLogP | 2.41 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|