C12H23N3 — CID 59908810
(2R)-2-[(Z,5S)-5-aminohex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 59908810) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (2R)-2-[(Z,5S)-5-aminohex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | (2R)-2-[(Z,5S)-5-aminohex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 59908810 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (2R)-2-[(Z,5S)-5-aminohex-2-enyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C[C@H](N)C/C=C\C[C@H]1CCCCC(N)=N1 |
| InChI | InChI=1S/C12H23N3/c1-10(13)6-2-3-7-11-8-4-5-9-12(14)15-11/h2-3,10-11H,4-9,13H2,1H3,(H2,14,15)/b3-2-/t10-,11-/m0/s1 |
| InChIKey | PBGULZJTYJPEAQ-NPRAVPSUSA-N |
| XLogP | 1.97 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|