C19H20N4O4 — CID 9084919
2,5-dimethyl-N'-[3-(3-methyl-4-oxoquinazolin-2-yl)propanoyl]furan-3-carbohydrazide (PubChem CID 9084919) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[3-(3-methyl-4-oxoquinazolin-2-yl)propanoyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[3-(3-methyl-4-oxoquinazolin-2-yl)propanoyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 9084919 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2,5-dimethyl-N'-[3-(3-methyl-4-oxoquinazolin-2-yl)propanoyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)CCc2nc3ccccc3c(=O)n2C)c(C)o1 |
| InChI | InChI=1S/C19H20N4O4/c1-11-10-14(12(2)27-11)18(25)22-21-17(24)9-8-16-20-15-7-5-4-6-13(15)19(26)23(16)3/h4-7,10H,8-9H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | KKHGXCSLHWTSJY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|