C17H23N3O4S — CID 90850084
3-(1-hexa-2,4-dien-3-yl-2,5-dihydroxypyrrol-3-yl)sulfanyl-2-(2-oxopyrrolidin-1-yl)propanamide (PubChem CID 90850084) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-(1-hexa-2,4-dien-3-yl-2,5-dihydroxypyrrol-3-yl)sulfanyl-2-(2-oxopyrrolidin-1-yl)propanamide.
| Compound Name | 3-(1-hexa-2,4-dien-3-yl-2,5-dihydroxypyrrol-3-yl)sulfanyl-2-(2-oxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 90850084 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-(1-hexa-2,4-dien-3-yl-2,5-dihydroxypyrrol-3-yl)sulfanyl-2-(2-oxopyrrolidin-1-yl)propanamide |
| SMILES | CC=CC(=CC)n1c(O)cc(SCC(C(N)=O)N2CCCC2=O)c1O |
| InChI | InChI=1S/C17H23N3O4S/c1-3-6-11(4-2)20-15(22)9-13(17(20)24)25-10-12(16(18)23)19-8-5-7-14(19)21/h3-4,6,9,12,22,24H,5,7-8,10H2,1-2H3,(H2,18,23) |
| InChIKey | QFRLZLYWJCLXET-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|