C16H27N3O3S — CID 91108276
N-butyl-3-[2,5-dihydroxy-3-(4-iminopentylsulfanyl)pyrrol-1-yl]propanamide (PubChem CID 91108276) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is N-butyl-3-[2,5-dihydroxy-3-(4-iminopentylsulfanyl)pyrrol-1-yl]propanamide.
| Compound Name | N-butyl-3-[2,5-dihydroxy-3-(4-iminopentylsulfanyl)pyrrol-1-yl]propanamide |
|---|---|
| PubChem CID | 91108276 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-butyl-3-[2,5-dihydroxy-3-(4-iminopentylsulfanyl)pyrrol-1-yl]propanamide |
| SMILES | [H]/N=C(\C)CCCSc1cc(O)n(CCC(=O)NCCCC)c1O |
| InChI | InChI=1S/C16H27N3O3S/c1-3-4-8-18-14(20)7-9-19-15(21)11-13(16(19)22)23-10-5-6-12(2)17/h11,17,21-22H,3-10H2,1-2H3,(H,18,20)/b17-12+ |
| InChIKey | KYFFIGCAAQGDTB-SFQUDFHCSA-N |
| XLogP | 3.12 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|