C20H19F3N2O3 — CID 90851253
(1R,7S)-4-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 90851253) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is (1R,7S)-4-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | (1R,7S)-4-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 90851253 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (1R,7S)-4-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1-c1cc(C(F)(F)F)ccc1N1CCOCC1)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)13-3-4-14(24-5-7-28-8-6-24)15(10-13)25-18(26)16-11-1-2-12(9-11)17(16)19(25)27/h1-4,10-12,26-27H,5-9H2/t11-,12+ |
| InChIKey | NHJUOAWYRRVOIH-TXEJJXNPSA-N |
| XLogP | 3.88 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|