C22H27N3O3 — CID 54247051
(7R)-4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 54247051) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (7R)-4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | (7R)-4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 54247051 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (7R)-4-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1CC(O)CN1CCN(c3ccccc3)CC1)[C@H]1C=CC2C1 |
| InChI | InChI=1S/C22H27N3O3/c26-18(13-23-8-10-24(11-9-23)17-4-2-1-3-5-17)14-25-21(27)19-15-6-7-16(12-15)20(19)22(25)28/h1-7,15-16,18,26-28H,8-14H2/t15-,16?,18?/m0/s1 |
| InChIKey | QTZPRYQXOLUURA-HJOIGYKYSA-N |
| XLogP | 2.22 |
| TPSA | 72.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|