C15H10F3NO2 — CID 91428014
(1S,7R)-4-(2,4,5-trifluorophenyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 91428014) has the molecular formula C15H10F3NO2 and a molecular weight of 293.24 g/mol. Its IUPAC name is (1S,7R)-4-(2,4,5-trifluorophenyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | (1S,7R)-4-(2,4,5-trifluorophenyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 91428014 |
| Molecular Formula | C15H10F3NO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (1S,7R)-4-(2,4,5-trifluorophenyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1-c1cc(F)c(F)cc1F)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C15H10F3NO2/c16-8-4-10(18)11(5-9(8)17)19-14(20)12-6-1-2-7(3-6)13(12)15(19)21/h1-2,4-7,20-21H,3H2/t6-,7+ |
| InChIKey | AADXOFNBHPXPSA-KNVOCYPGSA-N |
| XLogP | 3.45 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|