C17H11F6NO2 — CID 54116784
(7R)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 54116784) has the molecular formula C17H11F6NO2 and a molecular weight of 375.27 g/mol. Its IUPAC name is (7R)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | (7R)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 54116784 |
| Molecular Formula | C17H11F6NO2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (7R)-4-[3,5-bis(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1C=CC2C1 |
| InChI | InChI=1S/C17H11F6NO2/c18-16(19,20)9-4-10(17(21,22)23)6-11(5-9)24-14(25)12-7-1-2-8(3-7)13(12)15(24)26/h1-2,4-8,25-26H,3H2/t7-,8?/m0/s1 |
| InChIKey | NKWQOEMEMRYXDX-JAMMHHFISA-N |
| XLogP | 5.07 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|