C16H11F6NO2 — CID 54495389
2-[3,5-bis(trifluoromethyl)phenyl]-4,7-dihydroisoindole-1,3-diol (PubChem CID 54495389) has the molecular formula C16H11F6NO2 and a molecular weight of 363.26 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54495389 |
| Molecular Formula | C16H11F6NO2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1)CC=CC2 |
| InChI | InChI=1S/C16H11F6NO2/c17-15(18,19)8-5-9(16(20,21)22)7-10(6-8)23-13(24)11-3-1-2-4-12(11)14(23)25/h1-2,5-7,24-25H,3-4H2 |
| InChIKey | XYSFPSCDJVTTBP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|