C11H8F3NO2 — CID 54067064
1-(2,4-difluorophenyl)-3-(fluoromethyl)pyrrole-2,5-diol (PubChem CID 54067064) has the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(fluoromethyl)pyrrole-2,5-diol.
| Compound Name | 1-(2,4-difluorophenyl)-3-(fluoromethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54067064 |
| Molecular Formula | C11H8F3NO2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(fluoromethyl)pyrrole-2,5-diol |
| SMILES | Oc1cc(CF)c(O)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C11H8F3NO2/c12-5-6-3-10(16)15(11(6)17)9-2-1-7(13)4-8(9)14/h1-4,16-17H,5H2 |
| InChIKey | MDSWDEWDFRIQES-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |