C21H23Cl2N3O3 — CID 90893216
4-[2-[4-(3,4-dichlorophenyl)piperazin-1-yl]ethoxy]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 90893216) has the molecular formula C21H23Cl2N3O3 and a molecular weight of 436.34 g/mol. Its IUPAC name is 4-[2-[4-(3,4-dichlorophenyl)piperazin-1-yl]ethoxy]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | 4-[2-[4-(3,4-dichlorophenyl)piperazin-1-yl]ethoxy]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 90893216 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 4-[2-[4-(3,4-dichlorophenyl)piperazin-1-yl]ethoxy]-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1OCCN1CCN(c3ccc(Cl)c(Cl)c3)CC1)C1C=CC2C1 |
| InChI | InChI=1S/C21H23Cl2N3O3/c22-16-4-3-15(12-17(16)23)25-7-5-24(6-8-25)9-10-29-26-20(27)18-13-1-2-14(11-13)19(18)21(26)28/h1-4,12-14,27-28H,5-11H2 |
| InChIKey | AAANYVDZSAMYTQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|