C19H16FN5OS — CID 9085203
1-(2-fluorophenyl)-3-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]thiourea (PubChem CID 9085203) has the molecular formula C19H16FN5OS and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 9085203 |
| Molecular Formula | C19H16FN5OS |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[[(E)-3-(1-phenylpyrazol-4-yl)prop-2-enoyl]amino]thiourea |
| SMILES | O=C(/C=C/c1cnn(-c2ccccc2)c1)NNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C19H16FN5OS/c20-16-8-4-5-9-17(16)22-19(27)24-23-18(26)11-10-14-12-21-25(13-14)15-6-2-1-3-7-15/h1-13H,(H,23,26)(H2,22,24,27)/b11-10+ |
| InChIKey | NRFMCDMOXSTGHD-ZHACJKMWSA-N |
| XLogP | 3.04 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|