C15H26N2O2 — CID 90853797
methyl 1,2,8-trimethyl-5-(methylamino)-7-methylidene-2-azabicyclo[6.1.0]nonane-6-carboxylate (PubChem CID 90853797) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is methyl 1,2,8-trimethyl-5-(methylamino)-7-methylidene-2-azabicyclo[6.1.0]nonane-6-carboxylate.
| Compound Name | methyl 1,2,8-trimethyl-5-(methylamino)-7-methylidene-2-azabicyclo[6.1.0]nonane-6-carboxylate |
|---|---|
| PubChem CID | 90853797 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | methyl 1,2,8-trimethyl-5-(methylamino)-7-methylidene-2-azabicyclo[6.1.0]nonane-6-carboxylate |
| SMILES | C=C1C(C(=O)OC)C(NC)CCN(C)C2(C)CC12C |
| InChI | InChI=1S/C15H26N2O2/c1-10-12(13(18)19-6)11(16-4)7-8-17(5)15(3)9-14(10,15)2/h11-12,16H,1,7-9H2,2-6H3 |
| InChIKey | QQYNIGPNMKJLSE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|