C11H17NO3 — CID 134996344
methyl 6,6-dimethyl-2-methylidene-3,3a,4,5-tetrahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate (PubChem CID 134996344) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl 6,6-dimethyl-2-methylidene-3,3a,4,5-tetrahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate.
| Compound Name | methyl 6,6-dimethyl-2-methylidene-3,3a,4,5-tetrahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 134996344 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl 6,6-dimethyl-2-methylidene-3,3a,4,5-tetrahydropyrrolo[1,2-b][1,2]oxazole-3-carboxylate |
| SMILES | C=C1ON2C(CCC2(C)C)C1C(=O)OC |
| InChI | InChI=1S/C11H17NO3/c1-7-9(10(13)14-4)8-5-6-11(2,3)12(8)15-7/h8-9H,1,5-6H2,2-4H3 |
| InChIKey | TVQBBLPQLWADSG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |