C39H35N4O2PS — CID 90854393
1-(benzenesulfonyl)-5-(2-methylprop-1-enyl)-3-(1-methylpyrazol-4-yl)pyrrolo[2,3-b]pyridine;triphenylphosphane (PubChem CID 90854393) has the molecular formula C39H35N4O2PS and a molecular weight of 654.78 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-(2-methylprop-1-enyl)-3-(1-methylpyrazol-4-yl)pyrrolo[2,3-b]pyridine;triphenylphosphane.
| Compound Name | 1-(benzenesulfonyl)-5-(2-methylprop-1-enyl)-3-(1-methylpyrazol-4-yl)pyrrolo[2,3-b]pyridine;triphenylphosphane |
|---|---|
| PubChem CID | 90854393 |
| Molecular Formula | C39H35N4O2PS |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | 1-(benzenesulfonyl)-5-(2-methylprop-1-enyl)-3-(1-methylpyrazol-4-yl)pyrrolo[2,3-b]pyridine;triphenylphosphane |
| SMILES | CC(C)=Cc1cnc2c(c1)c(-c1cnn(C)c1)cn2S(=O)(=O)c1ccccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N4O2S.C18H15P/c1-15(2)9-16-10-19-20(17-12-23-24(3)13-17)14-25(21(19)22-11-16)28(26,27)18-7-5-4-6-8-18;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h4-14H,1-3H3;1-15H |
| InChIKey | XONWTMNUTPQPSJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|