C30H34O2 — CID 90856724
methyl 2-(9,9-dibutyl-6-methylfluoren-2-yl)benzoate (PubChem CID 90856724) has the molecular formula C30H34O2 and a molecular weight of 426.60 g/mol. Its IUPAC name is methyl 2-(9,9-dibutyl-6-methylfluoren-2-yl)benzoate.
| Compound Name | methyl 2-(9,9-dibutyl-6-methylfluoren-2-yl)benzoate |
|---|---|
| PubChem CID | 90856724 |
| Molecular Formula | C30H34O2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | methyl 2-(9,9-dibutyl-6-methylfluoren-2-yl)benzoate |
| SMILES | CCCCC1(CCCC)c2ccc(C)cc2-c2ccc(-c3ccccc3C(=O)OC)cc21 |
| InChI | InChI=1S/C30H34O2/c1-5-7-17-30(18-8-6-2)27-16-13-21(3)19-26(27)24-15-14-22(20-28(24)30)23-11-9-10-12-25(23)29(31)32-4/h9-16,19-20H,5-8,17-18H2,1-4H3 |
| InChIKey | ZQRJYXPBPLXPTM-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |