About 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine
2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine (PubChem CID 90857545) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine.
Analyze 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine?
The IUPAC name of 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine (CID 90857545) is 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine.
What is the SMILES notation for 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine?
The canonical SMILES for 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine is CN1CCC2CC=NC=C2C1.
What is the InChIKey of 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine?
The InChIKey is UVLZXPIPSPRPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-11-5-3-8-2-4-10-6-9(8)7-11/h4,6,8H,2-3,5,7H2,1H3.
What are the key properties of 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine?
2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine has a molecular weight of 150.22 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4,4a,5-tetrahydro-1H-2,7-naphthyridine is sourced from PubChem (CID 90857545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).