C27H35FO3 — CID 90857915
22-fluoro-2,20-dimethylspiro[hexacyclo[12.8.0.02,8.03,5.015,20.016,18]docos-7-ene-19,5'-oxolane]-2',6-dione (PubChem CID 90857915) has the molecular formula C27H35FO3 and a molecular weight of 426.57 g/mol. Its IUPAC name is 22-fluoro-2,20-dimethylspiro[hexacyclo[12.8.0.02,8.03,5.015,20.016,18]docos-7-ene-19,5'-oxolane]-2',6-dione.
| Compound Name | 22-fluoro-2,20-dimethylspiro[hexacyclo[12.8.0.02,8.03,5.015,20.016,18]docos-7-ene-19,5'-oxolane]-2',6-dione |
|---|---|
| PubChem CID | 90857915 |
| Molecular Formula | C27H35FO3 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 22-fluoro-2,20-dimethylspiro[hexacyclo[12.8.0.02,8.03,5.015,20.016,18]docos-7-ene-19,5'-oxolane]-2',6-dione |
| SMILES | CC12C(=CC(=O)C3CC31)CCCCCC1C2C(F)CC2(C)C1C1CC1C21CCC(=O)O1 |
| InChI | InChI=1S/C27H35FO3/c1-25-13-20(28)24-15(23(25)17-12-19(17)27(25)9-8-22(30)31-27)7-5-3-4-6-14-10-21(29)16-11-18(16)26(14,24)2/h10,15-20,23-24H,3-9,11-13H2,1-2H3 |
| InChIKey | VCILFQCENHZRRH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |