C13H18N4 — CID 90858078
(2S)-2-N,2-N-diamino-3-naphthalen-1-ylpropane-1,2-diamine (PubChem CID 90858078) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is (2S)-2-N,2-N-diamino-3-naphthalen-1-ylpropane-1,2-diamine.
| Compound Name | (2S)-2-N,2-N-diamino-3-naphthalen-1-ylpropane-1,2-diamine |
|---|---|
| PubChem CID | 90858078 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2S)-2-N,2-N-diamino-3-naphthalen-1-ylpropane-1,2-diamine |
| SMILES | NC[C@H](Cc1cccc2ccccc12)N(N)N |
| InChI | InChI=1S/C13H18N4/c14-9-12(17(15)16)8-11-6-3-5-10-4-1-2-7-13(10)11/h1-7,12H,8-9,14-16H2/t12-/m0/s1 |
| InChIKey | ZPAYGMXSBMVMIT-LBPRGKRZSA-N |
| XLogP | 0.76 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|