C24H27N3O4 — CID 90858422
9H-fluoren-9-ylmethyl N-[(3R,4S)-4-(1-deuterio-2-methylpropan-2-yl)oxy-1-diazo-2-oxopentan-3-yl]carbamate (PubChem CID 90858422) has the molecular formula C24H27N3O4 and a molecular weight of 422.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(3R,4S)-4-(1-deuterio-2-methylpropan-2-yl)oxy-1-diazo-2-oxopentan-3-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(3R,4S)-4-(1-deuterio-2-methylpropan-2-yl)oxy-1-diazo-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 90858422 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(3R,4S)-4-(1-deuterio-2-methylpropan-2-yl)oxy-1-diazo-2-oxopentan-3-yl]carbamate |
| SMILES | [2H]CC(C)(C)O[C@@H](C)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C24H27N3O4/c1-15(31-24(2,3)4)22(21(28)13-26-25)27-23(29)30-14-20-18-11-7-5-9-16(18)17-10-6-8-12-19(17)20/h5-13,15,20,22H,14H2,1-4H3,(H,27,29)/t15-,22+/m0/s1/i2D |
| InChIKey | GTTRJLULTVJSTQ-NNYCQKAOSA-N |
| XLogP | 3.97 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|