C16H20N2O — CID 90858974
N-(cyclopentylmethyl)-5-methyl-N-phenyl-1,2-oxazol-3-amine (PubChem CID 90858974) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-5-methyl-N-phenyl-1,2-oxazol-3-amine.
| Compound Name | N-(cyclopentylmethyl)-5-methyl-N-phenyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 90858974 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-(cyclopentylmethyl)-5-methyl-N-phenyl-1,2-oxazol-3-amine |
| SMILES | Cc1cc(N(CC2CCCC2)c2ccccc2)no1 |
| InChI | InChI=1S/C16H20N2O/c1-13-11-16(17-19-13)18(12-14-7-5-6-8-14)15-9-3-2-4-10-15/h2-4,9-11,14H,5-8,12H2,1H3 |
| InChIKey | XDAWUKMOOKPGBF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |