About (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide
(4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide (PubChem CID 90860345) has the molecular formula C24H26ClNO4S
and a molecular weight of 460.00 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide |
| PubChem CID | 90860345 |
| Molecular Formula | C24H26ClNO4S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide |
| SMILES | COc1cc(OC)c(C(C)C)cc1-c1ccccc1C(c1ccc(Cl)cc1)S(N)(=O)=O |
| InChI | InChI=1S/C24H26ClNO4S/c1-15(2)20-13-21(23(30-4)14-22(20)29-3)18-7-5-6-8-19(18)24(31(26,27)28)16-9-11-17(25)12-10-16/h5-15,24H,1-4H3,(H2,26,27,28) |
| InChIKey | NGEHEVOWSRGUHH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide?
The IUPAC name of (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide (CID 90860345) is (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide.
What is the SMILES notation for (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide?
The canonical SMILES for (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide is COc1cc(OC)c(C(C)C)cc1-c1ccccc1C(c1ccc(Cl)cc1)S(N)(=O)=O.
What is the InChIKey of (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide?
The InChIKey is NGEHEVOWSRGUHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26ClNO4S/c1-15(2)20-13-21(23(30-4)14-22(20)29-3)18-7-5-6-8-19(18)24(31(26,27)28)16-9-11-17(25)12-10-16/h5-15,24H,1-4H3,(H2,26,27,28).
What are the key properties of (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide?
(4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide has a molecular weight of 460.00 g/mol, XLogP of 5.53, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[2-(2,4-dimethoxy-5-propan-2-ylphenyl)phenyl]methanesulfonamide is sourced from PubChem (CID 90860345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).