C27H37NO3 — CID 90860528
(2S,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-2-[(3-methoxyphenyl)methyl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 90860528) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is (2S,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-2-[(3-methoxyphenyl)methyl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (2S,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-2-[(3-methoxyphenyl)methyl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 90860528 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (2S,3aS,3bR,5aR,9aR,9bS,11aS)-1-hydroxy-2-[(3-methoxyphenyl)methyl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | COc1cccc(C[C@@H]2C[C@H]3[C@@H]4CC[C@H]5N(C)C(=O)C=C[C@]5(C)[C@H]4CC[C@]3(C)C2O)c1 |
| InChI | InChI=1S/C27H37NO3/c1-26-13-11-24(29)28(3)23(26)9-8-20-21(26)10-12-27(2)22(20)16-18(25(27)30)14-17-6-5-7-19(15-17)31-4/h5-7,11,13,15,18,20-23,25,30H,8-10,12,14,16H2,1-4H3/t18-,20-,21+,22+,23-,25?,26-,27+/m1/s1 |
| InChIKey | JULKNAMQEOUGIX-FNUJOJPWSA-N |
| XLogP | 4.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |