C22H14Br2F5NS — CID 90861020
[4-[2,5-bis(4-bromophenyl)pyrrol-1-yl]phenyl]-pentafluoro-λ6-sulfane (PubChem CID 90861020) has the molecular formula C22H14Br2F5NS and a molecular weight of 579.23 g/mol. Its IUPAC name is [4-[2,5-bis(4-bromophenyl)pyrrol-1-yl]phenyl]-pentafluoro-λ6-sulfane.
| Compound Name | [4-[2,5-bis(4-bromophenyl)pyrrol-1-yl]phenyl]-pentafluoro-λ6-sulfane |
|---|---|
| PubChem CID | 90861020 |
| Molecular Formula | C22H14Br2F5NS |
| Molecular Weight | 579.23 g/mol |
| Exact Mass | 576.91 |
| IUPAC Name | [4-[2,5-bis(4-bromophenyl)pyrrol-1-yl]phenyl]-pentafluoro-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)c1ccc(-n2c(-c3ccc(Br)cc3)ccc2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H14Br2F5NS/c23-17-5-1-15(2-6-17)21-13-14-22(16-3-7-18(24)8-4-16)30(21)19-9-11-20(12-10-19)31(25,26,27,28)29/h1-14H |
| InChIKey | WEUHXCPGUOCRRA-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.23 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |