C20H19N3O4S — CID 90861509
(19S)-6-amino-19-hydroxy-19-methyl-10-tritio-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione;methanethiol (PubChem CID 90861509) has the molecular formula C20H19N3O4S and a molecular weight of 399.46 g/mol. Its IUPAC name is (19S)-6-amino-19-hydroxy-19-methyl-10-tritio-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione;methanethiol.
| Compound Name | (19S)-6-amino-19-hydroxy-19-methyl-10-tritio-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione;methanethiol |
|---|---|
| PubChem CID | 90861509 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (19S)-6-amino-19-hydroxy-19-methyl-10-tritio-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione;methanethiol |
| SMILES | CS.[3H]c1c2c(nc3cc(N)ccc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@@]3(C)O |
| InChI | InChI=1S/C19H15N3O4.CH4S/c1-19(25)13-6-15-16-10(4-9-2-3-11(20)5-14(9)21-16)7-22(15)17(23)12(13)8-26-18(19)24;1-2/h2-6,25H,7-8,20H2,1H3;2H,1H3/t19-;/m0./s1/i4T; |
| InChIKey | ATVIZUUDMYWBLA-OLOKSWMVSA-N |
| XLogP | 1.82 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|