C13H13F2NO4 — CID 90861649
methyl 4,4-difluoro-2-phenylmethoxycarbonyliminobutanoate (PubChem CID 90861649) has the molecular formula C13H13F2NO4 and a molecular weight of 285.25 g/mol. Its IUPAC name is methyl 4,4-difluoro-2-phenylmethoxycarbonyliminobutanoate.
| Compound Name | methyl 4,4-difluoro-2-phenylmethoxycarbonyliminobutanoate |
|---|---|
| PubChem CID | 90861649 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl 4,4-difluoro-2-phenylmethoxycarbonyliminobutanoate |
| SMILES | COC(=O)C(CC(F)F)=NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H13F2NO4/c1-19-12(17)10(7-11(14)15)16-13(18)20-8-9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3 |
| InChIKey | KVDJPHHYQIRDRP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|