C14H15FN4O3S2 — CID 9086285
[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 9086285) has the molecular formula C14H15FN4O3S2 and a molecular weight of 370.43 g/mol. Its IUPAC name is [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 9086285 |
| Molecular Formula | C14H15FN4O3S2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H15FN4O3S2/c1-10-13(23-17-16-10)14(20)18-6-8-19(9-7-18)24(21,22)12-5-3-2-4-11(12)15/h2-5H,6-9H2,1H3 |
| InChIKey | KJRLHLMTRIRDTJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |