C15H17ClN4O3S2 — CID 30796082
[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(4-ethylthiadiazol-5-yl)methanone (PubChem CID 30796082) has the molecular formula C15H17ClN4O3S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(4-ethylthiadiazol-5-yl)methanone.
| Compound Name | [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(4-ethylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 30796082 |
| Molecular Formula | C15H17ClN4O3S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | [4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-(4-ethylthiadiazol-5-yl)methanone |
| SMILES | CCc1nnsc1C(=O)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C15H17ClN4O3S2/c1-2-12-14(24-18-17-12)15(21)19-7-9-20(10-8-19)25(22,23)13-6-4-3-5-11(13)16/h3-6H,2,7-10H2,1H3 |
| InChIKey | QGOKHFPCYVCBLJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |