C12H16FN3S — CID 90864428
N-[1-(2-ethenyl-3-fluorohex-2-enyl)pyrazol-3-yl]methanethioamide (PubChem CID 90864428) has the molecular formula C12H16FN3S and a molecular weight of 253.35 g/mol. Its IUPAC name is N-[1-(2-ethenyl-3-fluorohex-2-enyl)pyrazol-3-yl]methanethioamide.
| Compound Name | N-[1-(2-ethenyl-3-fluorohex-2-enyl)pyrazol-3-yl]methanethioamide |
|---|---|
| PubChem CID | 90864428 |
| Molecular Formula | C12H16FN3S |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-[1-(2-ethenyl-3-fluorohex-2-enyl)pyrazol-3-yl]methanethioamide |
| SMILES | C=CC(Cn1ccc(NC=S)n1)=C(F)CCC |
| InChI | InChI=1S/C12H16FN3S/c1-3-5-11(13)10(4-2)8-16-7-6-12(15-16)14-9-17/h4,6-7,9H,2-3,5,8H2,1H3,(H,14,15,17) |
| InChIKey | DTUQANRKESGTLJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|