C29H45FN6O3 — CID 90864798
2-amino-2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-4-[(4-ethylpiperazin-1-yl)methyl]-2-fluoroanilino]-N-propan-2-ylacetamide (PubChem CID 90864798) has the molecular formula C29H45FN6O3 and a molecular weight of 544.72 g/mol. Its IUPAC name is 2-amino-2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-4-[(4-ethylpiperazin-1-yl)methyl]-2-fluoroanilino]-N-propan-2-ylacetamide.
| Compound Name | 2-amino-2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-4-[(4-ethylpiperazin-1-yl)methyl]-2-fluoroanilino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 90864798 |
| Molecular Formula | C29H45FN6O3 |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | 2-amino-2-[N-[amino-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)methyl]-4-[(4-ethylpiperazin-1-yl)methyl]-2-fluoroanilino]-N-propan-2-ylacetamide |
| SMILES | CCN1CCN(Cc2ccc(N(C(N)C(=O)NC(C)C)C(N)c3cc(C(C)C)c(OC)cc3O)c(F)c2)CC1 |
| InChI | InChI=1S/C29H45FN6O3/c1-7-34-10-12-35(13-11-34)17-20-8-9-24(23(30)14-20)36(28(32)29(38)33-19(4)5)27(31)22-15-21(18(2)3)26(39-6)16-25(22)37/h8-9,14-16,18-19,27-28,37H,7,10-13,17,31-32H2,1-6H3,(H,33,38) |
| InChIKey | ZJBXEUZPSYQBGU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|