C10H20O3 — CID 90865162
ethane;methanol;6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 90865162) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is ethane;methanol;6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | ethane;methanol;6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 90865162 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | ethane;methanol;6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | CC.CO.O=C1OC2CCCC1C2 |
| InChI | InChI=1S/C7H10O2.C2H6.CH4O/c8-7-5-2-1-3-6(4-5)9-7;2*1-2/h5-6H,1-4H2;1-2H3;2H,1H3 |
| InChIKey | GJCHZOXPDUSVTN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |