C14H28O10 — CID 90868246
2-[2-(methoxymethoxy)ethyl]propanedioic acid;2-[2-(methoxymethoxy)ethyl]propane-1,3-diol (PubChem CID 90868246) has the molecular formula C14H28O10 and a molecular weight of 356.37 g/mol. Its IUPAC name is 2-[2-(methoxymethoxy)ethyl]propanedioic acid;2-[2-(methoxymethoxy)ethyl]propane-1,3-diol.
| Compound Name | 2-[2-(methoxymethoxy)ethyl]propanedioic acid;2-[2-(methoxymethoxy)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 90868246 |
| Molecular Formula | C14H28O10 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[2-(methoxymethoxy)ethyl]propanedioic acid;2-[2-(methoxymethoxy)ethyl]propane-1,3-diol |
| SMILES | COCOCCC(C(=O)O)C(=O)O.COCOCCC(CO)CO |
| InChI | InChI=1S/C7H12O6.C7H16O4/c1-12-4-13-3-2-5(6(8)9)7(10)11;1-10-6-11-3-2-7(4-8)5-9/h5H,2-4H2,1H3,(H,8,9)(H,10,11);7-9H,2-6H2,1H3 |
| InChIKey | QWXBPRJAJQWRRP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|