C16H17ClN4O5S — CID 9086826
N'-[(E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoyl]furan-2-carbohydrazide (PubChem CID 9086826) has the molecular formula C16H17ClN4O5S and a molecular weight of 412.86 g/mol. Its IUPAC name is N'-[(E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoyl]furan-2-carbohydrazide.
| Compound Name | N'-[(E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9086826 |
| Molecular Formula | C16H17ClN4O5S |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N'-[(E)-3-[5-chloro-1-[(3S)-1,1-dioxothiolan-3-yl]-3-methylpyrazol-4-yl]prop-2-enoyl]furan-2-carbohydrazide |
| SMILES | Cc1nn([C@H]2CCS(=O)(=O)C2)c(Cl)c1/C=C/C(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H17ClN4O5S/c1-10-12(15(17)21(20-10)11-6-8-27(24,25)9-11)4-5-14(22)18-19-16(23)13-3-2-7-26-13/h2-5,7,11H,6,8-9H2,1H3,(H,18,22)(H,19,23)/b5-4+/t11-/m0/s1 |
| InChIKey | IHCDZRKEGCMJRF-ZWNMCFTASA-N |
| XLogP | 1.27 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|