About 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one
2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one (PubChem CID 90868264) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one.
Analyze 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one?
The IUPAC name of 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one (CID 90868264) is 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one.
What is the SMILES notation for 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one?
The canonical SMILES for 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one is C=C1N=C(C)C(=O)NC1C.
What is the InChIKey of 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one?
The InChIKey is MMIKWYJXAKVWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-4-5(2)9-7(10)6(3)8-4/h5H,1H2,2-3H3,(H,9,10).
What are the key properties of 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one?
2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one has a molecular weight of 138.17 g/mol, XLogP of 0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3-methylidene-1,2-dihydropyrazin-6-one is sourced from PubChem (CID 90868264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).