C11H19N3O — CID 143038659
3,6-dimethyl-1-[2-(propylamino)ethyl]pyrazin-2-one (PubChem CID 143038659) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,6-dimethyl-1-[2-(propylamino)ethyl]pyrazin-2-one.
| Compound Name | 3,6-dimethyl-1-[2-(propylamino)ethyl]pyrazin-2-one |
|---|---|
| PubChem CID | 143038659 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 3,6-dimethyl-1-[2-(propylamino)ethyl]pyrazin-2-one |
| SMILES | CCCNCCn1c(C)cnc(C)c1=O |
| InChI | InChI=1S/C11H19N3O/c1-4-5-12-6-7-14-9(2)8-13-10(3)11(14)15/h8,12H,4-7H2,1-3H3 |
| InChIKey | GBRVMEKGPVSPQV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|