C17H19N3O8S3 — CID 90869702
(4S,5R,6S)-3-[5,7-bis(methylsulfonyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-(2-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 90869702) has the molecular formula C17H19N3O8S3 and a molecular weight of 489.55 g/mol. Its IUPAC name is (4S,5R,6S)-3-[5,7-bis(methylsulfonyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-(2-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4S,5R,6S)-3-[5,7-bis(methylsulfonyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-(2-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 90869702 |
| Molecular Formula | C17H19N3O8S3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | (4S,5R,6S)-3-[5,7-bis(methylsulfonyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-(2-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@H]1C(c2cn3c(S(C)(=O)=O)nc(S(C)(=O)=O)c3s2)=C(C(=O)O)N2C(=O)[C@@H](CCO)[C@@H]12 |
| InChI | InChI=1S/C17H19N3O8S3/c1-7-10(12(16(23)24)20-11(7)8(4-5-21)14(20)22)9-6-19-15(29-9)13(30(2,25)26)18-17(19)31(3,27)28/h6-8,11,21H,4-5H2,1-3H3,(H,23,24)/t7-,8-,11+/m0/s1 |
| InChIKey | YUNARARFIIVBRK-DKCNOQQISA-N |
| XLogP | -0.14 |
| TPSA | 163.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |